C19H26N3O5S- — CID 175363744
6-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-sulfinatoamino]-2-oxo-3,4-dihydro-1H-quinoline (PubChem CID 175363744) has the molecular formula C19H26N3O5S- and a molecular weight of 408.50 g/mol. Its IUPAC name is 6-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-sulfinatoamino]-2-oxo-3,4-dihydro-1H-quinoline.
| Compound Name | 6-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-sulfinatoamino]-2-oxo-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 175363744 |
| Molecular Formula | C19H26N3O5S- |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 6-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-sulfinatoamino]-2-oxo-3,4-dihydro-1H-quinoline |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(c2ccc3c(c2)CCC(=O)N3)S(=O)[O-])CC1 |
| InChI | InChI=1S/C19H27N3O5S/c1-19(2,3)27-18(24)21-10-8-14(9-11-21)22(28(25)26)15-5-6-16-13(12-15)4-7-17(23)20-16/h5-6,12,14H,4,7-11H2,1-3H3,(H,20,23)(H,25,26)/p-1 |
| InChIKey | HFRFYKKKSUFHBS-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|