C13H21N3O3 — CID 164914870
tert-butyl 4-(5-oxo-1H-pyrazol-2-yl)piperidine-1-carboxylate (PubChem CID 164914870) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is tert-butyl 4-(5-oxo-1H-pyrazol-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-oxo-1H-pyrazol-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164914870 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | tert-butyl 4-(5-oxo-1H-pyrazol-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2ccc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C13H21N3O3/c1-13(2,3)19-12(18)15-7-4-10(5-8-15)16-9-6-11(17)14-16/h6,9-10H,4-5,7-8H2,1-3H3,(H,14,17) |
| InChIKey | FWOZDYVPRDIION-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |