C14H15F3N2O2 — CID 74250515
(1S,5R)-8-hydroxy-N-(2,3,5-trifluorophenyl)-3-azabicyclo[3.2.1]octane-3-carboxamide (PubChem CID 74250515) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is (1S,5R)-8-hydroxy-N-(2,3,5-trifluorophenyl)-3-azabicyclo[3.2.1]octane-3-carboxamide.
| Compound Name | (1S,5R)-8-hydroxy-N-(2,3,5-trifluorophenyl)-3-azabicyclo[3.2.1]octane-3-carboxamide |
|---|---|
| PubChem CID | 74250515 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (1S,5R)-8-hydroxy-N-(2,3,5-trifluorophenyl)-3-azabicyclo[3.2.1]octane-3-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1F)N1C[C@H]2CC[C@@H](C1)C2O |
| InChI | InChI=1S/C14H15F3N2O2/c15-9-3-10(16)12(17)11(4-9)18-14(21)19-5-7-1-2-8(6-19)13(7)20/h3-4,7-8,13,20H,1-2,5-6H2,(H,18,21)/t7-,8+,13? |
| InChIKey | XASQDUVQBQLRGB-RKSAZJRESA-N |
| XLogP | 2.34 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|