C13H15FN2O4 — CID 61439185
4-fluoro-2-[(3-hydroxypiperidine-1-carbonyl)amino]benzoic acid (PubChem CID 61439185) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 4-fluoro-2-[(3-hydroxypiperidine-1-carbonyl)amino]benzoic acid.
| Compound Name | 4-fluoro-2-[(3-hydroxypiperidine-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61439185 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-fluoro-2-[(3-hydroxypiperidine-1-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(F)cc1NC(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C13H15FN2O4/c14-8-3-4-10(12(18)19)11(6-8)15-13(20)16-5-1-2-9(17)7-16/h3-4,6,9,17H,1-2,5,7H2,(H,15,20)(H,18,19) |
| InChIKey | KJGINOFYMAUTGJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |