C12H13FN2O5 — CID 106670745
2-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-5-fluorobenzoic acid (PubChem CID 106670745) has the molecular formula C12H13FN2O5 and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-5-fluorobenzoic acid.
| Compound Name | 2-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 106670745 |
| Molecular Formula | C12H13FN2O5 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-5-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1NC(=O)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C12H13FN2O5/c13-6-1-2-8(7(3-6)11(18)19)14-12(20)15-4-9(16)10(17)5-15/h1-3,9-10,16-17H,4-5H2,(H,14,20)(H,18,19) |
| InChIKey | RTNUOXJOPTXQAW-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |