C12H13BrN2O5 — CID 106670643
3-bromo-4-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]benzoic acid (PubChem CID 106670643) has the molecular formula C12H13BrN2O5 and a molecular weight of 345.15 g/mol. Its IUPAC name is 3-bromo-4-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]benzoic acid.
| Compound Name | 3-bromo-4-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 106670643 |
| Molecular Formula | C12H13BrN2O5 |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 3-bromo-4-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)N2CC(O)C(O)C2)c(Br)c1 |
| InChI | InChI=1S/C12H13BrN2O5/c13-7-3-6(11(18)19)1-2-8(7)14-12(20)15-4-9(16)10(17)5-15/h1-3,9-10,16-17H,4-5H2,(H,14,20)(H,18,19) |
| InChIKey | XEYFAAKKWGVTCV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |