C11H12INO — CID 145283835
7-ethyl-6-iodo-3,4-dihydro-1H-quinolin-2-one (PubChem CID 145283835) has the molecular formula C11H12INO and a molecular weight of 301.13 g/mol. Its IUPAC name is 7-ethyl-6-iodo-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-ethyl-6-iodo-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 145283835 |
| Molecular Formula | C11H12INO |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 7-ethyl-6-iodo-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCc1cc2c(cc1I)CCC(=O)N2 |
| InChI | InChI=1S/C11H12INO/c1-2-7-6-10-8(5-9(7)12)3-4-11(14)13-10/h5-6H,2-4H2,1H3,(H,13,14) |
| InChIKey | FRUQVUYWJNIONV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|