C16H21IN2O3 — CID 174680119
2-(6-iodo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)ethyl N-tert-butylcarbamate (PubChem CID 174680119) has the molecular formula C16H21IN2O3 and a molecular weight of 416.26 g/mol. Its IUPAC name is 2-(6-iodo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)ethyl N-tert-butylcarbamate.
| Compound Name | 2-(6-iodo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174680119 |
| Molecular Formula | C16H21IN2O3 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 2-(6-iodo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)ethyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCc1cc2c(cc1I)CCC(=O)N2 |
| InChI | InChI=1S/C16H21IN2O3/c1-16(2,3)19-15(21)22-7-6-10-9-13-11(8-12(10)17)4-5-14(20)18-13/h8-9H,4-7H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | AQRMLLWMYIODRO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|