C16H21IN2O3 — CID 66982623
tert-butyl-[2-(6-iodo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)ethyl]carbamic acid (PubChem CID 66982623) has the molecular formula C16H21IN2O3 and a molecular weight of 416.26 g/mol. Its IUPAC name is tert-butyl-[2-(6-iodo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)ethyl]carbamic acid.
| Compound Name | tert-butyl-[2-(6-iodo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 66982623 |
| Molecular Formula | C16H21IN2O3 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | tert-butyl-[2-(6-iodo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)ethyl]carbamic acid |
| SMILES | CC(C)(C)N(CCc1cc2c(cc1I)CCC(=O)N2)C(=O)O |
| InChI | InChI=1S/C16H21IN2O3/c1-16(2,3)19(15(21)22)7-6-10-9-13-11(8-12(10)17)4-5-14(20)18-13/h8-9H,4-7H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | ALJKXLJLCJFURE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|