C13H14FNO4 — CID 61329541
2-[2-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethoxy]acetic acid (PubChem CID 61329541) has the molecular formula C13H14FNO4 and a molecular weight of 267.26 g/mol. Its IUPAC name is 2-[2-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethoxy]acetic acid.
| Compound Name | 2-[2-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethoxy]acetic acid |
|---|---|
| PubChem CID | 61329541 |
| Molecular Formula | C13H14FNO4 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-[2-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethoxy]acetic acid |
| SMILES | O=C(O)COCCc1cc2c(cc1F)NC(=O)CC2 |
| InChI | InChI=1S/C13H14FNO4/c14-10-6-11-9(1-2-12(16)15-11)5-8(10)3-4-19-7-13(17)18/h5-6H,1-4,7H2,(H,15,16)(H,17,18) |
| InChIKey | CITYMAAYSSXUFX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|