C14H19N3O2 — CID 115168783
[2-methyl-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)propyl]urea (PubChem CID 115168783) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is [2-methyl-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)propyl]urea.
| Compound Name | [2-methyl-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)propyl]urea |
|---|---|
| PubChem CID | 115168783 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | [2-methyl-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)propyl]urea |
| SMILES | CC(C)(CNC(N)=O)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H19N3O2/c1-14(2,8-16-13(15)19)10-4-5-11-9(7-10)3-6-12(18)17-11/h4-5,7H,3,6,8H2,1-2H3,(H,17,18)(H3,15,16,19) |
| InChIKey | ZGOAMJLNBQGZSR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |