C13H15BrN2O2 — CID 115194235
N-[2-methyl-2-(2-oxo-1,3-dihydroindol-5-yl)propyl]carbamoyl bromide (PubChem CID 115194235) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is N-[2-methyl-2-(2-oxo-1,3-dihydroindol-5-yl)propyl]carbamoyl bromide.
| Compound Name | N-[2-methyl-2-(2-oxo-1,3-dihydroindol-5-yl)propyl]carbamoyl bromide |
|---|---|
| PubChem CID | 115194235 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N-[2-methyl-2-(2-oxo-1,3-dihydroindol-5-yl)propyl]carbamoyl bromide |
| SMILES | CC(C)(CNC(=O)Br)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C13H15BrN2O2/c1-13(2,7-15-12(14)18)9-3-4-10-8(5-9)6-11(17)16-10/h3-5H,6-7H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | VREXEMQQNNOQSU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|