C13H12ClIN2O2 — CID 59405018
(4E)-8-chloro-4-(dimethylaminomethylidene)-7-iodo-1H-1-benzazepine-2,5-dione (PubChem CID 59405018) has the molecular formula C13H12ClIN2O2 and a molecular weight of 390.61 g/mol. Its IUPAC name is (4E)-8-chloro-4-(dimethylaminomethylidene)-7-iodo-1H-1-benzazepine-2,5-dione.
| Compound Name | (4E)-8-chloro-4-(dimethylaminomethylidene)-7-iodo-1H-1-benzazepine-2,5-dione |
|---|---|
| PubChem CID | 59405018 |
| Molecular Formula | C13H12ClIN2O2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | (4E)-8-chloro-4-(dimethylaminomethylidene)-7-iodo-1H-1-benzazepine-2,5-dione |
| SMILES | CN(C)/C=C1\CC(=O)Nc2cc(Cl)c(I)cc2C1=O |
| InChI | InChI=1S/C13H12ClIN2O2/c1-17(2)6-7-3-12(18)16-11-5-9(14)10(15)4-8(11)13(7)19/h4-6H,3H2,1-2H3,(H,16,18)/b7-6+ |
| InChIKey | VJUSJMCTUBAOFM-VOTSOKGWSA-N |
| XLogP | 2.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|