C12H13N3O2 — CID 45379057
(8E)-8-(dimethylaminomethylidene)-5H-pyrido[3,2-b]azepine-6,9-dione (PubChem CID 45379057) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is (8E)-8-(dimethylaminomethylidene)-5H-pyrido[3,2-b]azepine-6,9-dione.
| Compound Name | (8E)-8-(dimethylaminomethylidene)-5H-pyrido[3,2-b]azepine-6,9-dione |
|---|---|
| PubChem CID | 45379057 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | (8E)-8-(dimethylaminomethylidene)-5H-pyrido[3,2-b]azepine-6,9-dione |
| SMILES | CN(C)/C=C1\CC(=O)Nc2cccnc2C1=O |
| InChI | InChI=1S/C12H13N3O2/c1-15(2)7-8-6-10(16)14-9-4-3-5-13-11(9)12(8)17/h3-5,7H,6H2,1-2H3,(H,14,16)/b8-7+ |
| InChIKey | ZRWHWTHVGFVSNF-BQYQJAHWSA-N |
| XLogP | 1.05 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|