C14H13N3O2 — CID 67433554
(4Z)-4-(dimethylaminomethylidene)-2,5-dioxo-1H-1-benzazepine-8-carbonitrile (PubChem CID 67433554) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is (4Z)-4-(dimethylaminomethylidene)-2,5-dioxo-1H-1-benzazepine-8-carbonitrile.
| Compound Name | (4Z)-4-(dimethylaminomethylidene)-2,5-dioxo-1H-1-benzazepine-8-carbonitrile |
|---|---|
| PubChem CID | 67433554 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (4Z)-4-(dimethylaminomethylidene)-2,5-dioxo-1H-1-benzazepine-8-carbonitrile |
| SMILES | CN(C)/C=C1/CC(=O)Nc2cc(C#N)ccc2C1=O |
| InChI | InChI=1S/C14H13N3O2/c1-17(2)8-10-6-13(18)16-12-5-9(7-15)3-4-11(12)14(10)19/h3-5,8H,6H2,1-2H3,(H,16,18)/b10-8- |
| InChIKey | DFVJCSLHUZIMAZ-NTMALXAHSA-N |
| XLogP | 1.53 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|