C13H13IN2O2 — CID 66935066
4-(dimethylaminomethylidene)-7-iodo-1H-1-benzazepine-2,5-dione (PubChem CID 66935066) has the molecular formula C13H13IN2O2 and a molecular weight of 356.16 g/mol. Its IUPAC name is 4-(dimethylaminomethylidene)-7-iodo-1H-1-benzazepine-2,5-dione.
| Compound Name | 4-(dimethylaminomethylidene)-7-iodo-1H-1-benzazepine-2,5-dione |
|---|---|
| PubChem CID | 66935066 |
| Molecular Formula | C13H13IN2O2 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 4-(dimethylaminomethylidene)-7-iodo-1H-1-benzazepine-2,5-dione |
| SMILES | CN(C)C=C1CC(=O)Nc2ccc(I)cc2C1=O |
| InChI | InChI=1S/C13H13IN2O2/c1-16(2)7-8-5-12(17)15-11-4-3-9(14)6-10(11)13(8)18/h3-4,6-7H,5H2,1-2H3,(H,15,17) |
| InChIKey | MPFDMTRXDJBJJB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|