C17H16ClN3O4S2 — CID 56507209
S-[4-[(6-chloro-2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56507209) has the molecular formula C17H16ClN3O4S2 and a molecular weight of 425.92 g/mol. Its IUPAC name is S-[4-[(6-chloro-2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[(6-chloro-2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56507209 |
| Molecular Formula | C17H16ClN3O4S2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | S-[4-[(6-chloro-2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NS(=O)(=O)c2cc3c(cc2Cl)NC(=O)C3)cc1 |
| InChI | InChI=1S/C17H16ClN3O4S2/c1-21(2)17(23)26-12-5-3-11(4-6-12)20-27(24,25)15-7-10-8-16(22)19-14(10)9-13(15)18/h3-7,9,20H,8H2,1-2H3,(H,19,22) |
| InChIKey | NXEIUTOONNENED-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|