C14H13Cl2N3O3S2 — CID 56507595
S-[4-[(2,6-dichloro-3-pyridinyl)sulfonylamino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56507595) has the molecular formula C14H13Cl2N3O3S2 and a molecular weight of 406.32 g/mol. Its IUPAC name is S-[4-[(2,6-dichloro-3-pyridinyl)sulfonylamino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[(2,6-dichloro-3-pyridinyl)sulfonylamino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56507595 |
| Molecular Formula | C14H13Cl2N3O3S2 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | S-[4-[(2,6-dichloro-3-pyridinyl)sulfonylamino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NS(=O)(=O)c2ccc(Cl)nc2Cl)cc1 |
| InChI | InChI=1S/C14H13Cl2N3O3S2/c1-19(2)14(20)23-10-5-3-9(4-6-10)18-24(21,22)11-7-8-12(15)17-13(11)16/h3-8,18H,1-2H3 |
| InChIKey | NBNMKCPCZPELEI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|