C18H21N3O4S2 — CID 56544803
S-[4-[3-(benzenesulfonamido)propanoylamino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56544803) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is S-[4-[3-(benzenesulfonamido)propanoylamino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[3-(benzenesulfonamido)propanoylamino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56544803 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | S-[4-[3-(benzenesulfonamido)propanoylamino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NC(=O)CCNS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N3O4S2/c1-21(2)18(23)26-15-10-8-14(9-11-15)20-17(22)12-13-19-27(24,25)16-6-4-3-5-7-16/h3-11,19H,12-13H2,1-2H3,(H,20,22) |
| InChIKey | UGJYSBKZCJGERK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|