C18H20N2O4S2 — CID 42369414
3-[(4-acetylphenyl)sulfonylamino]-N-(4-methylsulfanylphenyl)propanamide (PubChem CID 42369414) has the molecular formula C18H20N2O4S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-[(4-acetylphenyl)sulfonylamino]-N-(4-methylsulfanylphenyl)propanamide.
| Compound Name | 3-[(4-acetylphenyl)sulfonylamino]-N-(4-methylsulfanylphenyl)propanamide |
|---|---|
| PubChem CID | 42369414 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 3-[(4-acetylphenyl)sulfonylamino]-N-(4-methylsulfanylphenyl)propanamide |
| SMILES | CSc1ccc(NC(=O)CCNS(=O)(=O)c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O4S2/c1-13(21)14-3-9-17(10-4-14)26(23,24)19-12-11-18(22)20-15-5-7-16(25-2)8-6-15/h3-10,19H,11-12H2,1-2H3,(H,20,22) |
| InChIKey | YCQMMKOMWDEATG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |