C19H22N2O6S2 — CID 56508487
2-[3-[[3-(dimethylcarbamoylsulfanyl)phenyl]sulfamoyl]-2,6-dimethylphenoxy]acetic acid (PubChem CID 56508487) has the molecular formula C19H22N2O6S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[3-[[3-(dimethylcarbamoylsulfanyl)phenyl]sulfamoyl]-2,6-dimethylphenoxy]acetic acid.
| Compound Name | 2-[3-[[3-(dimethylcarbamoylsulfanyl)phenyl]sulfamoyl]-2,6-dimethylphenoxy]acetic acid |
|---|---|
| PubChem CID | 56508487 |
| Molecular Formula | C19H22N2O6S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-[3-[[3-(dimethylcarbamoylsulfanyl)phenyl]sulfamoyl]-2,6-dimethylphenoxy]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(SC(=O)N(C)C)c2)c(C)c1OCC(=O)O |
| InChI | InChI=1S/C19H22N2O6S2/c1-12-8-9-16(13(2)18(12)27-11-17(22)23)29(25,26)20-14-6-5-7-15(10-14)28-19(24)21(3)4/h5-10,20H,11H2,1-4H3,(H,22,23) |
| InChIKey | KKZXPLVVRYAISF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|