C16H17NO7S2 — CID 68833726
3-(carboxymethoxy)-5-[3-(ethylsulfonylamino)phenyl]-4-methylthiophene-2-carboxylic acid (PubChem CID 68833726) has the molecular formula C16H17NO7S2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-(carboxymethoxy)-5-[3-(ethylsulfonylamino)phenyl]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-(carboxymethoxy)-5-[3-(ethylsulfonylamino)phenyl]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68833726 |
| Molecular Formula | C16H17NO7S2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 3-(carboxymethoxy)-5-[3-(ethylsulfonylamino)phenyl]-4-methylthiophene-2-carboxylic acid |
| SMILES | CCS(=O)(=O)Nc1cccc(-c2sc(C(=O)O)c(OCC(=O)O)c2C)c1 |
| InChI | InChI=1S/C16H17NO7S2/c1-3-26(22,23)17-11-6-4-5-10(7-11)14-9(2)13(24-8-12(18)19)15(25-14)16(20)21/h4-7,17H,3,8H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | OTXXXNGHDPSWRH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |