C21H17NO6S — CID 68837412
3-(carboxymethoxy)-4-methyl-5-[4-(phenylcarbamoyl)phenyl]thiophene-2-carboxylic acid (PubChem CID 68837412) has the molecular formula C21H17NO6S and a molecular weight of 411.44 g/mol. Its IUPAC name is 3-(carboxymethoxy)-4-methyl-5-[4-(phenylcarbamoyl)phenyl]thiophene-2-carboxylic acid.
| Compound Name | 3-(carboxymethoxy)-4-methyl-5-[4-(phenylcarbamoyl)phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68837412 |
| Molecular Formula | C21H17NO6S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 3-(carboxymethoxy)-4-methyl-5-[4-(phenylcarbamoyl)phenyl]thiophene-2-carboxylic acid |
| SMILES | Cc1c(-c2ccc(C(=O)Nc3ccccc3)cc2)sc(C(=O)O)c1OCC(=O)O |
| InChI | InChI=1S/C21H17NO6S/c1-12-17(28-11-16(23)24)19(21(26)27)29-18(12)13-7-9-14(10-8-13)20(25)22-15-5-3-2-4-6-15/h2-10H,11H2,1H3,(H,22,25)(H,23,24)(H,26,27) |
| InChIKey | QWDTZZWKMAVIIK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |