C21H13BrF3NO6S — CID 90830776
4-bromo-3-(carboxymethoxy)-5-[4-[phenyl(trifluoromethyl)carbamoyl]phenyl]thiophene-2-carboxylic acid (PubChem CID 90830776) has the molecular formula C21H13BrF3NO6S and a molecular weight of 544.30 g/mol. Its IUPAC name is 4-bromo-3-(carboxymethoxy)-5-[4-[phenyl(trifluoromethyl)carbamoyl]phenyl]thiophene-2-carboxylic acid.
| Compound Name | 4-bromo-3-(carboxymethoxy)-5-[4-[phenyl(trifluoromethyl)carbamoyl]phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 90830776 |
| Molecular Formula | C21H13BrF3NO6S |
| Molecular Weight | 544.30 g/mol |
| Exact Mass | 542.96 |
| IUPAC Name | 4-bromo-3-(carboxymethoxy)-5-[4-[phenyl(trifluoromethyl)carbamoyl]phenyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)COc1c(C(=O)O)sc(-c2ccc(C(=O)N(c3ccccc3)C(F)(F)F)cc2)c1Br |
| InChI | InChI=1S/C21H13BrF3NO6S/c22-15-16(32-10-14(27)28)18(20(30)31)33-17(15)11-6-8-12(9-7-11)19(29)26(21(23,24)25)13-4-2-1-3-5-13/h1-9H,10H2,(H,27,28)(H,30,31) |
| InChIKey | GFBAHJBXKDLOFC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.30 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|