C12H13NO2 — CID 169453981
6-(3-hydroxyprop-1-enyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 169453981) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 6-(3-hydroxyprop-1-enyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(3-hydroxyprop-1-enyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 169453981 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 6-(3-hydroxyprop-1-enyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C=CCO)ccc2N1 |
| InChI | InChI=1S/C12H13NO2/c14-7-1-2-9-3-5-11-10(8-9)4-6-12(15)13-11/h1-3,5,8,14H,4,6-7H2,(H,13,15) |
| InChIKey | VIXHQRRAIZROJY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |