C9H9ClN2O — CID 117209542
6-amino-5-chloro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 117209542) has the molecular formula C9H9ClN2O and a molecular weight of 196.64 g/mol. Its IUPAC name is 6-amino-5-chloro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-amino-5-chloro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 117209542 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 6-amino-5-chloro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Nc1ccc2c(c1Cl)CCC(=O)N2 |
| InChI | InChI=1S/C9H9ClN2O/c10-9-5-1-4-8(13)12-7(5)3-2-6(9)11/h2-3H,1,4,11H2,(H,12,13) |
| InChIKey | JVWUKWNKOBGHHS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|