C15H14O2 — CID 154253176
2-methyl-9,10-dihydrophenanthrene-1,4-diol (PubChem CID 154253176) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-methyl-9,10-dihydrophenanthrene-1,4-diol.
| Compound Name | 2-methyl-9,10-dihydrophenanthrene-1,4-diol |
|---|---|
| PubChem CID | 154253176 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-methyl-9,10-dihydrophenanthrene-1,4-diol |
| SMILES | Cc1cc(O)c2c(c1O)CCc1ccccc1-2 |
| InChI | InChI=1S/C15H14O2/c1-9-8-13(16)14-11-5-3-2-4-10(11)6-7-12(14)15(9)17/h2-5,8,16-17H,6-7H2,1H3 |
| InChIKey | YYHIFZLNUYLCGE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|