C18H15BO2 — CID 141414000
7,8-dihydrobenzo[c]phenanthren-6-ylboronic acid (PubChem CID 141414000) has the molecular formula C18H15BO2 and a molecular weight of 274.13 g/mol. Its IUPAC name is 7,8-dihydrobenzo[c]phenanthren-6-ylboronic acid.
| Compound Name | 7,8-dihydrobenzo[c]phenanthren-6-ylboronic acid |
|---|---|
| PubChem CID | 141414000 |
| Molecular Formula | C18H15BO2 |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 7,8-dihydrobenzo[c]phenanthren-6-ylboronic acid |
| SMILES | OB(O)c1cc2ccccc2c2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C18H15BO2/c20-19(21)17-11-13-6-2-4-8-15(13)18-14-7-3-1-5-12(14)9-10-16(17)18/h1-8,11,20-21H,9-10H2 |
| InChIKey | SZERENLAQLJWNZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|