C10H8FIO — CID 131320491
8-fluoro-6-iodo-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 131320491) has the molecular formula C10H8FIO and a molecular weight of 290.07 g/mol. Its IUPAC name is 8-fluoro-6-iodo-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 8-fluoro-6-iodo-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 131320491 |
| Molecular Formula | C10H8FIO |
| Molecular Weight | 290.07 g/mol |
| Exact Mass | 289.96 |
| IUPAC Name | 8-fluoro-6-iodo-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1CCc2cc(I)cc(F)c2C1 |
| InChI | InChI=1S/C10H8FIO/c11-10-4-7(12)3-6-1-2-8(13)5-9(6)10/h3-4H,1-2,5H2 |
| InChIKey | PRWDSEYPPVOHBK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.07 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|