About 2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one
2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one (PubChem CID 170903437) has the molecular formula C11H10F2O
and a molecular weight of 196.20 g/mol. Its IUPAC name is 2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one.
Analyze 2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one?
The IUPAC name of 2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one (CID 170903437) is 2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one.
What is the SMILES notation for 2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one?
The canonical SMILES for 2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one is O=C1CCc2cc(F)c(F)cc2CC1.
What is the InChIKey of 2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one?
The InChIKey is YENKUFPRBGMUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2O/c12-10-5-7-1-3-9(14)4-2-8(7)6-11(10)13/h5-6H,1-4H2.
What are the key properties of 2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one?
2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one has a molecular weight of 196.20 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one is sourced from PubChem (CID 170903437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).