C10H7FO2 — CID 164603309
7-fluoro-1-oxo-2,3-dihydroindene-5-carbaldehyde (PubChem CID 164603309) has the molecular formula C10H7FO2 and a molecular weight of 178.16 g/mol. Its IUPAC name is 7-fluoro-1-oxo-2,3-dihydroindene-5-carbaldehyde.
| Compound Name | 7-fluoro-1-oxo-2,3-dihydroindene-5-carbaldehyde |
|---|---|
| PubChem CID | 164603309 |
| Molecular Formula | C10H7FO2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 7-fluoro-1-oxo-2,3-dihydroindene-5-carbaldehyde |
| SMILES | O=Cc1cc(F)c2c(c1)CCC2=O |
| InChI | InChI=1S/C10H7FO2/c11-8-4-6(5-12)3-7-1-2-9(13)10(7)8/h3-5H,1-2H2 |
| InChIKey | JISFZYUMQOZSQK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|