C11H5F2NO2S — CID 143858625
2-(2,6-difluoro-4-formylphenyl)-1,3-thiazole-4-carbaldehyde (PubChem CID 143858625) has the molecular formula C11H5F2NO2S and a molecular weight of 253.23 g/mol. Its IUPAC name is 2-(2,6-difluoro-4-formylphenyl)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-(2,6-difluoro-4-formylphenyl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 143858625 |
| Molecular Formula | C11H5F2NO2S |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 2-(2,6-difluoro-4-formylphenyl)-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1cc(F)c(-c2nc(C=O)cs2)c(F)c1 |
| InChI | InChI=1S/C11H5F2NO2S/c12-8-1-6(3-15)2-9(13)10(8)11-14-7(4-16)5-17-11/h1-5H |
| InChIKey | ULVXNKNNEFVKTG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|