C10H5F2NOS — CID 63663256
2-(2,5-difluorophenyl)-1,3-thiazole-4-carbaldehyde (PubChem CID 63663256) has the molecular formula C10H5F2NOS and a molecular weight of 225.22 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-(2,5-difluorophenyl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 63663256 |
| Molecular Formula | C10H5F2NOS |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1csc(-c2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C10H5F2NOS/c11-6-1-2-9(12)8(3-6)10-13-7(4-14)5-15-10/h1-5H |
| InChIKey | JUEGTTSDGYHVRI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|