C9H7F2N3S — CID 116892077
[2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]hydrazine (PubChem CID 116892077) has the molecular formula C9H7F2N3S and a molecular weight of 227.24 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]hydrazine.
| Compound Name | [2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]hydrazine |
|---|---|
| PubChem CID | 116892077 |
| Molecular Formula | C9H7F2N3S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | [2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]hydrazine |
| SMILES | NNc1csc(-c2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C9H7F2N3S/c10-5-1-2-7(11)6(3-5)9-13-8(14-12)4-15-9/h1-4,14H,12H2 |
| InChIKey | WUCIEASBTJEVMC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|