C10H8ClIO — CID 131312486
8-chloro-7-iodo-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 131312486) has the molecular formula C10H8ClIO and a molecular weight of 306.53 g/mol. Its IUPAC name is 8-chloro-7-iodo-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 8-chloro-7-iodo-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 131312486 |
| Molecular Formula | C10H8ClIO |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | 8-chloro-7-iodo-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1CCc2ccc(I)c(Cl)c2C1 |
| InChI | InChI=1S/C10H8ClIO/c11-10-8-5-7(13)3-1-6(8)2-4-9(10)12/h2,4H,1,3,5H2 |
| InChIKey | FGKXEXBYVMTEFE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|