C10H6ClN3O2S — CID 91620771
5-chloro-3-pyrazol-1-yl-1,2-benzothiazole 1,1-dioxide (PubChem CID 91620771) has the molecular formula C10H6ClN3O2S and a molecular weight of 267.70 g/mol. Its IUPAC name is 5-chloro-3-pyrazol-1-yl-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 5-chloro-3-pyrazol-1-yl-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 91620771 |
| Molecular Formula | C10H6ClN3O2S |
| Molecular Weight | 267.70 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 5-chloro-3-pyrazol-1-yl-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(n2cccn2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H6ClN3O2S/c11-7-2-3-9-8(6-7)10(13-17(9,15)16)14-5-1-4-12-14/h1-6H |
| InChIKey | WYITWAKQSOFTFW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.70 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |