C12H7ClN2O3S — CID 14317532
6-chloro-2-imidazol-1-yl-1,1-dioxothiochromen-4-one (PubChem CID 14317532) has the molecular formula C12H7ClN2O3S and a molecular weight of 294.72 g/mol. Its IUPAC name is 6-chloro-2-imidazol-1-yl-1,1-dioxothiochromen-4-one.
| Compound Name | 6-chloro-2-imidazol-1-yl-1,1-dioxothiochromen-4-one |
|---|---|
| PubChem CID | 14317532 |
| Molecular Formula | C12H7ClN2O3S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 6-chloro-2-imidazol-1-yl-1,1-dioxothiochromen-4-one |
| SMILES | O=C1C=C(n2ccnc2)S(=O)(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H7ClN2O3S/c13-8-1-2-11-9(5-8)10(16)6-12(19(11,17)18)15-4-3-14-7-15/h1-7H |
| InChIKey | BLSPFPHGAMEMNA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |