C9H6ClO3S- — CID 20614841
6-chloro-2-methyl-1,1-dioxo-1-benzothiophen-3-olate (PubChem CID 20614841) has the molecular formula C9H6ClO3S- and a molecular weight of 229.66 g/mol. Its IUPAC name is 6-chloro-2-methyl-1,1-dioxo-1-benzothiophen-3-olate.
| Compound Name | 6-chloro-2-methyl-1,1-dioxo-1-benzothiophen-3-olate |
|---|---|
| PubChem CID | 20614841 |
| Molecular Formula | C9H6ClO3S- |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | 6-chloro-2-methyl-1,1-dioxo-1-benzothiophen-3-olate |
| SMILES | CC1=C([O-])c2ccc(Cl)cc2S1(=O)=O |
| InChI | InChI=1S/C9H7ClO3S/c1-5-9(11)7-3-2-6(10)4-8(7)14(5,12)13/h2-4,11H,1H3/p-1 |
| InChIKey | RLXSDXQVFZKQBZ-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |