C7H5ClN2O2S — CID 155431939
1-amino-6-chloro-1-oxo-1,2-benzothiazol-3-one (PubChem CID 155431939) has the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. Its IUPAC name is 1-amino-6-chloro-1-oxo-1,2-benzothiazol-3-one.
| Compound Name | 1-amino-6-chloro-1-oxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 155431939 |
| Molecular Formula | C7H5ClN2O2S |
| Molecular Weight | 216.65 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 1-amino-6-chloro-1-oxo-1,2-benzothiazol-3-one |
| SMILES | NS1(=O)=NC(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C7H5ClN2O2S/c8-4-1-2-5-6(3-4)13(9,12)10-7(5)11/h1-3H,(H2,9,10,11,12) |
| InChIKey | FZMJERSEQSMTAF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.65 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |