About 5-chloroindazol-3-one
5-chloroindazol-3-one (PubChem CID 23063946) has the molecular formula C7H3ClN2O
and a molecular weight of 166.57 g/mol. Its IUPAC name is 5-chloroindazol-3-one.
Molecular Properties
| Compound Name | 5-chloroindazol-3-one |
| PubChem CID | 23063946 |
| Molecular Formula | C7H3ClN2O |
| Molecular Weight | 166.57 g/mol |
| Exact Mass | 165.99 |
| IUPAC Name | 5-chloroindazol-3-one |
| SMILES | O=C1N=Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C7H3ClN2O/c8-4-1-2-6-5(3-4)7(11)10-9-6/h1-3H |
| InChIKey | FKCOGUDKADCPIB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloroindazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloroindazol-3-one?
The IUPAC name of 5-chloroindazol-3-one (CID 23063946) is 5-chloroindazol-3-one.
What is the SMILES notation for 5-chloroindazol-3-one?
The canonical SMILES for 5-chloroindazol-3-one is O=C1N=Nc2ccc(Cl)cc21.
What is the InChIKey of 5-chloroindazol-3-one?
The InChIKey is FKCOGUDKADCPIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClN2O/c8-4-1-2-6-5(3-4)7(11)10-9-6/h1-3H.
What are the key properties of 5-chloroindazol-3-one?
5-chloroindazol-3-one has a molecular weight of 166.57 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloroindazol-3-one is sourced from PubChem (CID 23063946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).