About 6-chloro-3-diazoindazole
6-chloro-3-diazoindazole (PubChem CID 71351828) has the molecular formula C7H3ClN4
and a molecular weight of 178.58 g/mol. Its IUPAC name is 6-chloro-3-diazoindazole.
Molecular Properties
| Compound Name | 6-chloro-3-diazoindazole |
| PubChem CID | 71351828 |
| Molecular Formula | C7H3ClN4 |
| Molecular Weight | 178.58 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | 6-chloro-3-diazoindazole |
| SMILES | [N-]=[N+]=C1N=Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C7H3ClN4/c8-4-1-2-5-6(3-4)11-12-7(5)10-9/h1-3H |
| InChIKey | YXHLSCOIHMUMAL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.58 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-diazoindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-diazoindazole?
The IUPAC name of 6-chloro-3-diazoindazole (CID 71351828) is 6-chloro-3-diazoindazole.
What is the SMILES notation for 6-chloro-3-diazoindazole?
The canonical SMILES for 6-chloro-3-diazoindazole is [N-]=[N+]=C1N=Nc2cc(Cl)ccc21.
What is the InChIKey of 6-chloro-3-diazoindazole?
The InChIKey is YXHLSCOIHMUMAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClN4/c8-4-1-2-5-6(3-4)11-12-7(5)10-9/h1-3H.
What are the key properties of 6-chloro-3-diazoindazole?
6-chloro-3-diazoindazole has a molecular weight of 178.58 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-diazoindazole is sourced from PubChem (CID 71351828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).