C9H5Cl2N5 — CID 136926372
5-azido-3-(2,4-dichlorophenyl)-1H-pyrazole (PubChem CID 136926372) has the molecular formula C9H5Cl2N5 and a molecular weight of 254.08 g/mol. Its IUPAC name is 5-azido-3-(2,4-dichlorophenyl)-1H-pyrazole.
| Compound Name | 5-azido-3-(2,4-dichlorophenyl)-1H-pyrazole |
|---|---|
| PubChem CID | 136926372 |
| Molecular Formula | C9H5Cl2N5 |
| Molecular Weight | 254.08 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | 5-azido-3-(2,4-dichlorophenyl)-1H-pyrazole |
| SMILES | [N-]=[N+]=Nc1cc(-c2ccc(Cl)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C9H5Cl2N5/c10-5-1-2-6(7(11)3-5)8-4-9(14-13-8)15-16-12/h1-4H,(H,13,14) |
| InChIKey | MLPFPHCFDRYPKQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.08 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|