C11H11N5O2 — CID 136926401
5-azido-3-(2,5-dimethoxyphenyl)-1H-pyrazole (PubChem CID 136926401) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is 5-azido-3-(2,5-dimethoxyphenyl)-1H-pyrazole.
| Compound Name | 5-azido-3-(2,5-dimethoxyphenyl)-1H-pyrazole |
|---|---|
| PubChem CID | 136926401 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 5-azido-3-(2,5-dimethoxyphenyl)-1H-pyrazole |
| SMILES | COc1ccc(OC)c(-c2cc(N=[N+]=[N-])[nH]n2)c1 |
| InChI | InChI=1S/C11H11N5O2/c1-17-7-3-4-10(18-2)8(5-7)9-6-11(14-13-9)15-16-12/h3-6H,1-2H3,(H,13,14) |
| InChIKey | HYZPIQKCIQAGEC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|