C13H16BrN3O2 — CID 116826014
4-bromo-5-(2,5-dimethoxyphenyl)-N,N-dimethyl-1H-pyrazol-3-amine (PubChem CID 116826014) has the molecular formula C13H16BrN3O2 and a molecular weight of 326.19 g/mol. Its IUPAC name is 4-bromo-5-(2,5-dimethoxyphenyl)-N,N-dimethyl-1H-pyrazol-3-amine.
| Compound Name | 4-bromo-5-(2,5-dimethoxyphenyl)-N,N-dimethyl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 116826014 |
| Molecular Formula | C13H16BrN3O2 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 4-bromo-5-(2,5-dimethoxyphenyl)-N,N-dimethyl-1H-pyrazol-3-amine |
| SMILES | COc1ccc(OC)c(-c2[nH]nc(N(C)C)c2Br)c1 |
| InChI | InChI=1S/C13H16BrN3O2/c1-17(2)13-11(14)12(15-16-13)9-7-8(18-3)5-6-10(9)19-4/h5-7H,1-4H3,(H,15,16) |
| InChIKey | STXMLBDUBHZNQO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |