C8H4ClN3O2 — CID 15179076
4-(3-chlorophenyl)-1,2,4-triazole-3,5-dione (PubChem CID 15179076) has the molecular formula C8H4ClN3O2 and a molecular weight of 209.59 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-1,2,4-triazole-3,5-dione.
| Compound Name | 4-(3-chlorophenyl)-1,2,4-triazole-3,5-dione |
|---|---|
| PubChem CID | 15179076 |
| Molecular Formula | C8H4ClN3O2 |
| Molecular Weight | 209.59 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | 4-(3-chlorophenyl)-1,2,4-triazole-3,5-dione |
| SMILES | O=C1N=NC(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H4ClN3O2/c9-5-2-1-3-6(4-5)12-7(13)10-11-8(12)14/h1-4H |
| InChIKey | LFIUHNACDUEFIQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |