C12H11ClN2O3 — CID 112598230
1-(3-chlorophenyl)-5,5-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 112598230) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5,5-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(3-chlorophenyl)-5,5-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112598230 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1-(3-chlorophenyl)-5,5-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC1(C)C(=O)NC(=O)N(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C12H11ClN2O3/c1-12(2)9(16)14-11(18)15(10(12)17)8-5-3-4-7(13)6-8/h3-6H,1-2H3,(H,14,16,18) |
| InChIKey | KJKUNZCOOFBKAI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|