C13H10ClN3O3 — CID 115948815
4-chloro-3-(5,5-dimethyl-2,4,6-trioxo-1,3-diazinan-1-yl)benzonitrile (PubChem CID 115948815) has the molecular formula C13H10ClN3O3 and a molecular weight of 291.69 g/mol. Its IUPAC name is 4-chloro-3-(5,5-dimethyl-2,4,6-trioxo-1,3-diazinan-1-yl)benzonitrile.
| Compound Name | 4-chloro-3-(5,5-dimethyl-2,4,6-trioxo-1,3-diazinan-1-yl)benzonitrile |
|---|---|
| PubChem CID | 115948815 |
| Molecular Formula | C13H10ClN3O3 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-chloro-3-(5,5-dimethyl-2,4,6-trioxo-1,3-diazinan-1-yl)benzonitrile |
| SMILES | CC1(C)C(=O)NC(=O)N(c2cc(C#N)ccc2Cl)C1=O |
| InChI | InChI=1S/C13H10ClN3O3/c1-13(2)10(18)16-12(20)17(11(13)19)9-5-7(6-15)3-4-8(9)14/h3-5H,1-2H3,(H,16,18,20) |
| InChIKey | XFTGYZVQPLIBIK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|