C14H13N3O4 — CID 104850258
4-(5-ethyl-2,4,6-trioxo-1,3-diazinan-1-yl)-3-methoxybenzonitrile (PubChem CID 104850258) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 4-(5-ethyl-2,4,6-trioxo-1,3-diazinan-1-yl)-3-methoxybenzonitrile.
| Compound Name | 4-(5-ethyl-2,4,6-trioxo-1,3-diazinan-1-yl)-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 104850258 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-(5-ethyl-2,4,6-trioxo-1,3-diazinan-1-yl)-3-methoxybenzonitrile |
| SMILES | CCC1C(=O)NC(=O)N(c2ccc(C#N)cc2OC)C1=O |
| InChI | InChI=1S/C14H13N3O4/c1-3-9-12(18)16-14(20)17(13(9)19)10-5-4-8(7-15)6-11(10)21-2/h4-6,9H,3H2,1-2H3,(H,16,18,20) |
| InChIKey | GOSDDDZEIMCUQO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|