C12H10N2O3S — CID 104849274
4-(3,5-dioxothiomorpholin-4-yl)-3-methoxybenzonitrile (PubChem CID 104849274) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is 4-(3,5-dioxothiomorpholin-4-yl)-3-methoxybenzonitrile.
| Compound Name | 4-(3,5-dioxothiomorpholin-4-yl)-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 104849274 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 4-(3,5-dioxothiomorpholin-4-yl)-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1N1C(=O)CSCC1=O |
| InChI | InChI=1S/C12H10N2O3S/c1-17-10-4-8(5-13)2-3-9(10)14-11(15)6-18-7-12(14)16/h2-4H,6-7H2,1H3 |
| InChIKey | KOVVNAKEJOKSEU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|