C13H8N4O3 — CID 104850150
1-(4-cyano-2-methoxyphenyl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 104850150) has the molecular formula C13H8N4O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is 1-(4-cyano-2-methoxyphenyl)-2,4-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1-(4-cyano-2-methoxyphenyl)-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 104850150 |
| Molecular Formula | C13H8N4O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-(4-cyano-2-methoxyphenyl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | COc1cc(C#N)ccc1-n1cc(C#N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H8N4O3/c1-20-11-4-8(5-14)2-3-10(11)17-7-9(6-15)12(18)16-13(17)19/h2-4,7H,1H3,(H,16,18,19) |
| InChIKey | UZVWYZMOGXOBLE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |